Perfluorodecaneamide structure
|
Common Name | Perfluorodecaneamide | ||
|---|---|---|---|---|
| CAS Number | 307-40-4 | Molecular Weight | 513.09900 | |
| Density | 1.719g/cm3 | Boiling Point | 223.6ºC at 760mmHg | |
| Molecular Formula | C10H2F19NO | Melting Point | 161-163ºC | |
| MSDS | N/A | Flash Point | 89ºC | |
| Name | Perfluorodecaneamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.719g/cm3 |
|---|---|
| Boiling Point | 223.6ºC at 760mmHg |
| Melting Point | 161-163ºC |
| Molecular Formula | C10H2F19NO |
| Molecular Weight | 513.09900 |
| Flash Point | 89ºC |
| Exact Mass | 512.98300 |
| PSA | 43.09000 |
| LogP | 5.81670 |
| Index of Refraction | 1.293 |
| InChIKey | ZNCMYBRWOIPANY-UHFFFAOYSA-N |
| SMILES | NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | 22-24/25 |
|
~%
Perfluorodecaneamide CAS#:307-40-4 |
| Literature: Minnesota Mining and Mfg.Co. Patent: US2593737 , 1949 ; DRP/DRBP Org.Chem. Full Text Show Details Minnesota Mining and Mfg.Co. Patent: DE836796 , 1949 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanamide |