4-fluorobenzylmagnesium chloride 0.25m& structure
|
Common Name | 4-fluorobenzylmagnesium chloride 0.25m& | ||
|---|---|---|---|---|
| CAS Number | 38046-82-1 | Molecular Weight | 261.39800 | |
| Density | 0.966 g/mL at 25 °C | Boiling Point | 35 °C | |
| Molecular Formula | C11H9BrMgO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -13 °F | |
| Name | magnesium,6-methoxy-2H-naphthalen-2-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.966 g/mL at 25 °C |
|---|---|
| Boiling Point | 35 °C |
| Molecular Formula | C11H9BrMgO |
| Molecular Weight | 261.39800 |
| Flash Point | -13 °F |
| Exact Mass | 259.96900 |
| PSA | 9.23000 |
| LogP | 3.49420 |
| InChIKey | DMMNAMUAQVNNBC-UHFFFAOYSA-M |
| SMILES | COc1ccc2c[c-]ccc2c1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | F+,C,F |
|---|---|
| Risk Phrases | R12 |
| Safety Phrases | 9-16-29-33-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| Hazard Class | 3.0 |
| HS Code | 2931900090 |
|
~%
4-fluorobenzylm... CAS#:38046-82-1 |
| Literature: Smith, Vanessa; Nigro, Anthony; Mulvihill, Mark; Cesario, Cara; Beck, Patricia Anne; Castelhano, Arlindo L. Patent: US2006/9645 A1, 2006 ; Location in patent: Page/Page column 43 ; |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD01311488 |
| 6-Methoxy-2-naphthylmagnesium bromide solution |
| 6-Methoxy-2-naphthylmagnesium bromide |
| 6-methoxynaphthalene 2-bromomagnesium salt |
| 6-Methoxy-2-naphthylmagnesium bromide 0.5 M in Tetrahydrofuran |