Jacareubin structure
|
Common Name | Jacareubin | ||
|---|---|---|---|---|
| CAS Number | 3811-29-8 | Molecular Weight | 326.30 | |
| Density | 1.493g/cm3 | Boiling Point | 553.1ºC at 760 mmHg | |
| Molecular Formula | C18H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.5ºC | |
Use of JacareubinJacareubin is a xanthone compound that can be isolated from Calophyllum brasiliense. Jacareubin has antibacterial, antioxidant, gastroprotective properties, and also has certain cancer cell toxicity, which can be used in cancer research[1]. |
| Name | 5,9,10-trihydroxy-2,2-dimethylpyrano[3,2-b]xanthen-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | Jacareubin is a xanthone compound that can be isolated from Calophyllum brasiliense. Jacareubin has antibacterial, antioxidant, gastroprotective properties, and also has certain cancer cell toxicity, which can be used in cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.493g/cm3 |
|---|---|
| Boiling Point | 553.1ºC at 760 mmHg |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 |
| Flash Point | 206.5ºC |
| Exact Mass | 326.07900 |
| PSA | 100.13000 |
| LogP | 3.24720 |
| Index of Refraction | 1.693 |
| InChIKey | UCLUVPCGXYTYEK-UHFFFAOYSA-N |
| SMILES | CC1(C)C=Cc2c(cc3oc4c(O)c(O)ccc4c(=O)c3c2O)O1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| xanthone V1 |
| 5,9,10-Trihydroxy-2,2-dimethyl-2H-pyrano[3,2-b]xanthen-6-on |
| Jacareubin |
| sulfasalazine |
| 5,9,10-trihydroxy-2,2-dimethyl-2H,6H-pyrano[3,2-b]xanthen-6-one |
| 2H,6H-Pyrano[3,2-b]xanthen-6-one,5,9,10-trihydroxy-2,2-dimethyl |
| 5,9,10-trihydroxy-2,2-dimethyl-2H-pyrano[3,2-b]xanthen-6-one |