1,3,5,6-Tetrahydroxyxanthone structure
|
Common Name | 1,3,5,6-Tetrahydroxyxanthone | ||
|---|---|---|---|---|
| CAS Number | 5084-31-1 | Molecular Weight | 260.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1,3,5,6-Tetrahydroxyxanthone1,3,5,6-Tetrahydroxyxanthone is a natural xanthone that can be isolated from Garcinia achachairu Rusby (Clusiaceae) branches. 1,3,5,6-Tetrahydroxyxanthone induces diuresis and saluresis in normotensive and hypertensive rats[1]. |
| Name | 1,3,5,6-tetrahydroxyxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Description | 1,3,5,6-Tetrahydroxyxanthone is a natural xanthone that can be isolated from Garcinia achachairu Rusby (Clusiaceae) branches. 1,3,5,6-Tetrahydroxyxanthone induces diuresis and saluresis in normotensive and hypertensive rats[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H8O6 |
|---|---|
| Molecular Weight | 260.19900 |
| Exact Mass | 260.03200 |
| PSA | 111.13000 |
| LogP | 1.76860 |
| InChIKey | CCEBJWKUMKKCDF-UHFFFAOYSA-N |
| SMILES | O=c1c2ccc(O)c(O)c2oc2cc(O)cc(O)c12 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| 1,3,5,6-tetrahydroxy-9H-xanthen-9-one |
| 1,3,56,7-tetrahydroxyxanthone |
| 1,3,5,6-Tetrahydroxyxanthon |
| 1,3,5,6-Tetrahydroxyxantone |
| 1,3,5,6-tetrahydroxy-xanthen-9-one |
| 1,3,5,6-Tetrahydroxy-xanthen-9-on |
| 9H-Xanthen-9-one,1,3,5,6-tetrahydroxy |
| 1,3,5,6-tetrahydroxyxanthone |