Macimorelin Acetate structure
|
Common Name | Macimorelin Acetate | ||
|---|---|---|---|---|
| CAS Number | 381231-18-1 | Molecular Weight | 474.555 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 948.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C26H30N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 527.5±34.3 °C | |
Use of Macimorelin AcetateMacimorelin (EP-1572), a GH secretagogue, is an orally active GHSR agonist. Macimorelin stimulates GH release. Macimorelin can be used in the research of adult growth hormone deficiency (AGHD), and Cancer anorexia-cachexia syndrome (CACS)[1][2][3]. |
| Name | 2-amino-N-[(2R)-1-[[(1R)-1-formamido-2-(1H-indol-3-yl)ethyl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-2-methylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Description | Macimorelin (EP-1572), a GH secretagogue, is an orally active GHSR agonist. Macimorelin stimulates GH release. Macimorelin can be used in the research of adult growth hormone deficiency (AGHD), and Cancer anorexia-cachexia syndrome (CACS)[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
GHSR[1] |
| In Vivo | Macimorelin (5 mg/kg, i.p. twice daily for 2 weeks) decreases the number and duration of seizures in IHKA mouse model[2]. Animal Model: Intrahippocampal kainic acid (IHKA) mouse model[2] Dosage: 5 mg/kg Administration: Intraperitoneal injection (i.p.), twice daily for 2 weeks. Result: Significantly decreased the number and duration of seizures during the treatment period, but had no antiepileptogenic or disease-modifying effect. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 948.6±65.0 °C at 760 mmHg |
| Molecular Formula | C26H30N6O3 |
| Molecular Weight | 474.555 |
| Flash Point | 527.5±34.3 °C |
| Exact Mass | 474.237946 |
| PSA | 151.88000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | UJVDJAPJQWZRFR-DHIUTWEWSA-N |
| SMILES | CC(C)(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)NC=O |
| 2-Methylalanyl-N-[(1R)-1-formamido-2-(1H-indol-3-yl)ethyl]-D-tryptophanamide |
| JMV 1843 |
| Macimorelin |
| UNII-8680B21W73 |
| D-Tryptophanamide, 2-methylalanyl-N-[(1R)-1-(formylamino)-2-(1H-indol-3-yl)ethyl]- |
| AEZS-130 |
| Macimorelin Acetate |