2,4,5-T-trolamine structure
|
Common Name | 2,4,5-T-trolamine | ||
|---|---|---|---|---|
| CAS Number | 3813-14-7 | Molecular Weight | 404.67100 | |
| Density | N/A | Boiling Point | 376.3ºC at 760mmHg | |
| Molecular Formula | C14H20Cl3NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | 2,4,5-T-trolamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 376.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H20Cl3NO6 |
| Molecular Weight | 404.67100 |
| Flash Point | 181.4ºC |
| Exact Mass | 403.03600 |
| PSA | 110.46000 |
| LogP | 1.37550 |
| InChIKey | VTZDSNBPOOWJST-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1cc(Cl)c(Cl)cc1Cl.OCCN(CCO)CCO |
| RIDADR | UN 3345 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2923900090 |
|
~93%
2,4,5-T-trolamine CAS#:3813-14-7 |
| Literature: Voronkov, M. G.; Semenova, N. V.; Kazimirovskaya, V. B.; Kholdeeva, L. N.; Moskvitina, L. T.; et al. Pharmaceutical Chemistry Journal, 1986 , vol. 20, # 8 p. 555 - 558 Khimiko-Farmatsevticheskii Zhurnal, 1986 , vol. 20, # 8 p. 952 - 956 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (2,4,5-trichlorophenoxy)acetic acid - 2,2’,2″-nitrilotriethanol (1:1) |
| 2,4,5-TTRIETHANOLAMINESALT |
| 2,4,5-trichlorophenoxyacetic acid triethanolamine salt |
| (2,4,5-trichlorophenoxy)acetic acid—2,2’,2″-nitrilotri(ethan-1-ol) |
| 2-(2,4,5-trichlorophenoxy)acetic acid compound with 2,2’,2″-nitrilotris[ethanol] (1:1) |
| tris(2-hydroxyethyl)ammonium (2,4,5-trichlorophenoxy)acetate |
| tri(2-hydroxyethyl)ammonium (2,4,5-trichlorophenoxy)acetate |