Biphenyl-4-carboxamide structure
|
Common Name | Biphenyl-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 3815-20-1 | Molecular Weight | 197.23300 | |
| Density | 1.137g/cm3 | Boiling Point | 381.4ºC at 760 mmHg | |
| Molecular Formula | C13H11NO | Melting Point | 227-229°C | |
| MSDS | Chinese USA | Flash Point | 184.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-biphenylcarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 381.4ºC at 760 mmHg |
| Melting Point | 227-229°C |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.23300 |
| Flash Point | 184.5ºC |
| Exact Mass | 197.08400 |
| PSA | 43.09000 |
| LogP | 3.15280 |
| Index of Refraction | 1.605 |
| InChIKey | LUQVCHRDAGWYMG-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(-c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25-S37-S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Rational strategy for shaped nanomaterial synthesis in reverse micelle reactors.
Nat. Commun. 5 , 3870, (2014) The shape-controlled synthesis of nanoparticles was established in single-phase solutions by controlling growth directions of crystalline facets on seed nanocrystals kinetically; however, it was diffi... |
| MFCD00017573 |
| 4-phenylbenzamide |
| Biphenyl-4-carboxamide |