2',3'-O-Isopropylidene-5-hydroxyMethyl uridine structure
|
Common Name | 2',3'-O-Isopropylidene-5-hydroxyMethyl uridine | ||
|---|---|---|---|---|
| CAS Number | 3816-77-1 | Molecular Weight | 314.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2',3'-O-Isopropylidene-5-hydroxyMethyl uridine5-(Hydroxymethyl)-2′,3′-O-(1-methylethylidene)uridine is a thymidine analog. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
| Name | 2',3'-O-isopropylidene-5-hydroxymethyl-uridine |
|---|---|
| Synonym | More Synonyms |
| Description | 5-(Hydroxymethyl)-2′,3′-O-(1-methylethylidene)uridine is a thymidine analog. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H18N2O7 |
|---|---|
| Molecular Weight | 314.29 |
| Exact Mass | 314.11100 |
| PSA | 123.01000 |
| InChIKey | HXPQPPUFFZZKIT-TURQNECASA-N |
| SMILES | CC1(C)OC2C(CO)OC(n3cc(CO)c(=O)[nH]c3=O)C2O1 |
| 2',3'-O-isopropylidene-5-hydroxymethyluridine |
| 5-hydroxymethyl-2',3'-O-isopropylideneuridine |
| 5-hydroxymethyl-2',3'-isopropylidene-uridine |
| 5-hydroxymethyl-O2',O3'-isopropylidene-uridine |
| 1-(2,3-O-isopropylidene-β-D-ribofuranosyl)-5-hydroxy-methyluracil |