(R)-Verapamil hydrochloride structure
|
Common Name | (R)-Verapamil hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 38176-02-2 | Molecular Weight | 477.03600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H39ClN2O4 | Melting Point | 129-131℃ | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of (R)-Verapamil hydrochloride(R)-Verapamil hydrochloride ((R)-(+)-Verapamil hydrochloride) is a P-Glycoprotein inhibitor. (R)-Verapamil hydrochloride blocks MRP1 mediated transport, resulting in chemosensitization of MRP1-overexpressing cells to anticancer drugs[1][2]. |
| Name | R(+)-Verapamil monohydrochloride hydrate |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-Verapamil hydrochloride ((R)-(+)-Verapamil hydrochloride) is a P-Glycoprotein inhibitor. (R)-Verapamil hydrochloride blocks MRP1 mediated transport, resulting in chemosensitization of MRP1-overexpressing cells to anticancer drugs[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 129-131℃ |
|---|---|
| Molecular Formula | C27H39ClN2O4 |
| Molecular Weight | 477.03600 |
| Exact Mass | 476.24400 |
| PSA | 65.15000 |
| LogP | 0.43398 |
| InChIKey | DOQPXTMNIUCOSY-HZPIKELBSA-N |
| SMILES | COc1ccc(CCN(C)CCCC(C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC.Cl |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | 23/24/25 |
| Safety Phrases | 22-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| (+)-[3-cyano-3-(3,4-dimethoxyphenyl)hex-6-yl](5,6-dimethoxyphenethyl)methylammonium chloride |