1,1,1,3,3,3-Hexafluoro-2-(trifluoromethyl)propane structure
|
Common Name | 1,1,1,3,3,3-Hexafluoro-2-(trifluoromethyl)propane | ||
|---|---|---|---|---|
| CAS Number | 382-24-1 | Molecular Weight | 220.03600 | |
| Density | 1.526 g/cm3 | Boiling Point | 12-14ºC | |
| Molecular Formula | C4HF9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,3,3,3-Hexafluoro-2-(trifluoromethyl)propane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.526 g/cm3 |
|---|---|
| Boiling Point | 12-14ºC |
| Molecular Formula | C4HF9 |
| Molecular Weight | 220.03600 |
| Exact Mass | 219.99300 |
| LogP | 3.28950 |
| Index of Refraction | 1.24 |
| InChIKey | IMRLDNHHTCXOOR-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(C(F)(F)F)C(F)(F)F |
| Hazard Codes | T |
|---|---|
| Risk Phrases | 23/24/25 |
| Safety Phrases | 36/37/39-45 |
| HS Code | 2903399090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Tris(trifluoromethyl)methane |
| 2-H-perfluoro-2-methylpropane |
| 1,1,1,3,3,3-Hexafluor-2-trifluormethyl-propan |
| Propane,1,1,1,3,3,3-hexafluoro-2-trifluoromethyl |
| Isobutane,perfluoro |
| 1,1,1,3,3,3-hexafluoro-2-trifluoromethyl-propane |
| PC7670D |
| 2-(Trifluoromethyl)-1,1,1,3,3,3-hexafluoropropane |