8-bromo-6-methyl-2-(2H-tetrazol-5-yl)chromen-4-one structure
|
Common Name | 8-bromo-6-methyl-2-(2H-tetrazol-5-yl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 38243-73-1 | Molecular Weight | 307.10300 | |
| Density | 1.809g/cm3 | Boiling Point | 503.3ºC at 760 mmHg | |
| Molecular Formula | C11H7BrN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.2ºC | |
| Name | 8-bromo-6-methyl-2-(2H-tetrazol-5-yl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.809g/cm3 |
|---|---|
| Boiling Point | 503.3ºC at 760 mmHg |
| Molecular Formula | C11H7BrN4O2 |
| Molecular Weight | 307.10300 |
| Flash Point | 258.2ºC |
| Exact Mass | 305.97500 |
| PSA | 84.67000 |
| LogP | 2.04400 |
| Index of Refraction | 1.697 |
| InChIKey | ZZKLEPZCFSNQQU-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c2oc(-c3nn[nH]n3)cc(=O)c2c1 |
| HS Code | 2934999090 |
|---|
|
~%
8-bromo-6-methy... CAS#:38243-73-1 |
| Literature: Ellis; Shaw Journal of medicinal chemistry, 1972 , vol. 15, # 8 p. 865 - 867 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-bromo-6-methyl-2-(2h-tetrazol-5-yl)-4h-chromen-4-one |
| 8-Bromo-6-methyl-2-(1H-tetrazol-5-yl)-4H-1-benzopyran-4-one |
| 4H-1-Benzopyran-4-one,8-bromo-6-methyl-2-(1H-tetrazol-5-yl) |
| 8-bromo-6-methyl-2-(1H-tetrazol-5-yl)-chromen-4-one |