9,10-Ethanoanthracen-1,8-dicarbonsaeure structure
|
Common Name | 9,10-Ethanoanthracen-1,8-dicarbonsaeure | ||
|---|---|---|---|---|
| CAS Number | 38378-71-1 | Molecular Weight | 294.30100 | |
| Density | 1.417g/cm3 | Boiling Point | 481.7ºC at 760 mmHg | |
| Molecular Formula | C18H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.2ºC | |
| Name | 9,10-Ethanoanthracen-1,8-dicarbonsaeure |
|---|
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 481.7ºC at 760 mmHg |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30100 |
| Flash Point | 259.2ºC |
| Exact Mass | 294.08900 |
| PSA | 74.60000 |
| LogP | 3.45400 |
| Index of Refraction | 1.692 |
| InChIKey | JYACZJOMRIGIRE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c1C1CCC2c2cccc(C(=O)O)c21 |
|
~%
9,10-Ethanoanth... CAS#:38378-71-1 |
| Literature: Golden,R.; Stock,L.M. Journal of the American Chemical Society, 1972 , vol. 94, # 9 p. 3080 - 3088 |
|
~%
9,10-Ethanoanth... CAS#:38378-71-1 |
| Literature: Golden,R.; Stock,L.M. Journal of the American Chemical Society, 1972 , vol. 94, # 9 p. 3080 - 3088 |
|
~%
9,10-Ethanoanth... CAS#:38378-71-1 |
| Literature: Golden,R.; Stock,L.M. Journal of the American Chemical Society, 1972 , vol. 94, # 9 p. 3080 - 3088 |