9,10-Anthracenedione,1,8-diamino-4,5-dihydroxy structure
|
Common Name | 9,10-Anthracenedione,1,8-diamino-4,5-dihydroxy | ||
|---|---|---|---|---|
| CAS Number | 128-94-9 | Molecular Weight | 270.24000 | |
| Density | 1.683g/cm3 | Boiling Point | 649.4ºC at 760mmHg | |
| Molecular Formula | C14H10N2O4 | Melting Point | 300ºC | |
| MSDS | N/A | Flash Point | 346.6ºC | |
| Name | 1,8-diamino-4,5-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.683g/cm3 |
|---|---|
| Boiling Point | 649.4ºC at 760mmHg |
| Melting Point | 300ºC |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24000 |
| Flash Point | 346.6ºC |
| Exact Mass | 270.06400 |
| PSA | 126.64000 |
| LogP | 2.20000 |
| Vapour Pressure | 1.82E-17mmHg at 25°C |
| Index of Refraction | 1.836 |
| InChIKey | SJHHHHHQWQOCDQ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(O)c2c1C(=O)c1c(N)ccc(O)c1C2=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~98%
9,10-Anthracene... CAS#:128-94-9 |
| Literature: Chang; Cheng Synthetic Communications, 1995 , vol. 25, # 13 p. 1893 - 1900 |
|
~%
9,10-Anthracene... CAS#:128-94-9 |
| Literature: US4250102 A1, ; |
|
~96%
9,10-Anthracene... CAS#:128-94-9 |
| Literature: Kumar, P. Hareesh; Rao, G. Venkateshwara; Narayanaswamy; Reddy, G. Chandrasekara Synthetic Communications, 2010 , vol. 40, # 23 p. 3501 - 3505 |
|
~%
9,10-Anthracene... CAS#:128-94-9 |
| Literature: Chemische Berichte, , vol. 61, p. 988 |
|
~%
9,10-Anthracene... CAS#:128-94-9 |
| Literature: Synthetic Communications, , vol. 25, # 13 p. 1893 - 1900 |
|
~%
9,10-Anthracene... CAS#:128-94-9 |
| Literature: Chemische Berichte, , vol. 61, p. 988 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,8-Dihydroxy-4,5-diaminoanthraquinone |
| 1,8-dihydroxy-anthraquinone |
| 1,8-Diamino-4,5-dihydroxy-anthrachinon |
| 1,8-Diaminochrysazine |
| EINECS 204-921-0 |
| 1,8-Diamino-4,5-dihydroxyanthraquinone |
| 4,5-Diamino-1,8-dihydroxyanthraquinone |
| 4,5-Diaminochrysazin |
| MFCD00053072 |
| 1,8-diamino-4,5-dihydroxylanthraquinone |
| 9,10-Anthracenedione,1,8-diamino-4,5-dihydroxy |