1,4-bis(benzenesulfonyloxy)benzene structure
|
Common Name | 1,4-bis(benzenesulfonyloxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 3840-05-9 | Molecular Weight | 390.43000 | |
| Density | 1.41g/cm3 | Boiling Point | 580.7ºC at 760 mmHg | |
| Molecular Formula | C18H14O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305ºC | |
| Name | [4-(benzenesulfonyloxy)phenyl] benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 580.7ºC at 760 mmHg |
| Molecular Formula | C18H14O6S2 |
| Molecular Weight | 390.43000 |
| Flash Point | 305ºC |
| Exact Mass | 390.02300 |
| PSA | 103.50000 |
| LogP | 5.38360 |
| Index of Refraction | 1.62 |
| InChIKey | YABVILCILGOKJI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1ccc(OS(=O)(=O)c2ccccc2)cc1)c1ccccc1 |
| HS Code | 2904100000 |
|---|
|
~%
1,4-bis(benzene... CAS#:3840-05-9 |
| Literature: Georgescu Chemische Berichte, 1891 , vol. 24, p. 417 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,4-bis(benzenesulfonyloxy)benzene |
| Quinol dibenzolsulphonat |
| Hydrochinonbenzolsulfonat |
| 1,4-Bis-benzolsulfonyloxy-benzol |