4-chloro-3-nitro-chromen-2-one structure
|
Common Name | 4-chloro-3-nitro-chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 38464-20-9 | Molecular Weight | 225.585 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 338.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H4ClNO4 | Melting Point | 160-164 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 158.6±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-3-nitrocoumarin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.7±42.0 °C at 760 mmHg |
| Melting Point | 160-164 °C(lit.) |
| Molecular Formula | C9H4ClNO4 |
| Molecular Weight | 225.585 |
| Flash Point | 158.6±27.9 °C |
| Exact Mass | 224.982880 |
| PSA | 76.03000 |
| LogP | 1.54 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | OFLRQEKOAGDHKT-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccccc2c(Cl)c1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~98%
4-chloro-3-nitr... CAS#:38464-20-9 |
| Literature: Govori; Rapic; Leci; Cacic; Tabakovic Journal of Heterocyclic Chemistry, 1996 , vol. 33, # 2 p. 351 - 354 |
| Precursor 1 | |
|---|---|
| DownStream 9 | |
| 4-chloro-3-nitrochromen-2-one |
| 2H-1-Benzopyran-2-one, 4-chloro-3-nitro- |
| MFCD00051670 |
| 4-chloro-3-nitro-chromen-2-one |
| 4-Chloro-3-nitro-2H-chromen-2-one |
| 4-Chloro-3-nitrocouMarin |