Benzoic acid,3,4,5-trihydroxy-, 2-methylpropyl ester structure
|
Common Name | Benzoic acid,3,4,5-trihydroxy-, 2-methylpropyl ester | ||
|---|---|---|---|---|
| CAS Number | 3856-05-1 | Molecular Weight | 226.22600 | |
| Density | 1.311g/cm3 | Boiling Point | 444.3ºC at 760mmHg | |
| Molecular Formula | C11H14O5 | Melting Point | 142 °C | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | Isobutyl Gallate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 444.3ºC at 760mmHg |
| Melting Point | 142 °C |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.22600 |
| Flash Point | 175.4ºC |
| Exact Mass | 226.08400 |
| PSA | 86.99000 |
| LogP | 1.61620 |
| Index of Refraction | 1.581 |
| InChIKey | UCLHVCFKZSLALE-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)c1cc(O)c(O)c(O)c1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2918290000 |
|
~%
Benzoic acid,3,... CAS#:3856-05-1 |
| Literature: Sakurai; Tanabe Yakugaku Zasshi, 1949 , vol. 69, p. 434 Chem.Abstr., 1950 , p. 4201 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 2-methylpropyl 3,4,5-trihydroxybenzoate |
| ISOBUTYL GALLATE |
| Gallic Acid Isobutyl Ester |
| MFCD00016425 |
| EINECS 223-363-9 |