1-ethyl-3-[4-[2-hydroxy-3-(tert-butylamino)propoxy]phenyl]urea structure
|
Common Name | 1-ethyl-3-[4-[2-hydroxy-3-(tert-butylamino)propoxy]phenyl]urea | ||
|---|---|---|---|---|
| CAS Number | 38649-69-3 | Molecular Weight | 309.40400 | |
| Density | 1.114g/cm3 | Boiling Point | 459.6ºC at 760 mmHg | |
| Molecular Formula | C16H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.7ºC | |
| Name | 1-[4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-3-ethylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 459.6ºC at 760 mmHg |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.40400 |
| Flash Point | 231.7ºC |
| Exact Mass | 309.20500 |
| PSA | 86.11000 |
| LogP | 2.62410 |
| Index of Refraction | 1.548 |
| InChIKey | ZGESGEQWQQQWGH-UHFFFAOYSA-N |
| SMILES | CCNC(=O)Nc1ccc(OCC(O)CNC(C)(C)C)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
1-ethyl-3-[4-[2... CAS#:38649-69-3 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
|
~%
1-ethyl-3-[4-[2... CAS#:38649-69-3 |
| Literature: Eckardt; Carstens; Fiedler Pharmazie, 1975 , vol. 30, # 10 p. 633 - 637 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Urea,N-(4-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)phenyl)-N'-ethyl |
| 1-{4-[3-(tert-butylamino)-2-hydroxypropoxy]phenyl}-3-ethylurea |
| N-(4-(3-((1,1-Dimethylethyl)amino)-2-hydroxypropoxy)phenyl)-N'-ethylurea |