2-phenyl-1,3-thiazole-4,5-dicarboxylic acid structure
|
Common Name | 2-phenyl-1,3-thiazole-4,5-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 38707-83-4 | Molecular Weight | 249.24300 | |
| Density | 1.534g/cm3 | Boiling Point | 526.056ºC at 760 mmHg | |
| Molecular Formula | C11H7NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.949ºC | |
| Name | 2-phenyl-1,3-thiazole-4,5-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.534g/cm3 |
|---|---|
| Boiling Point | 526.056ºC at 760 mmHg |
| Molecular Formula | C11H7NO4S |
| Molecular Weight | 249.24300 |
| Flash Point | 271.949ºC |
| Exact Mass | 249.01000 |
| PSA | 115.73000 |
| LogP | 2.20650 |
| Index of Refraction | 1.677 |
| InChIKey | TVHXQIGBVCWCIS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nc(-c2ccccc2)sc1C(=O)O |
| HS Code | 2934100090 |
|---|
|
~%
2-phenyl-1,3-th... CAS#:38707-83-4 |
| Literature: Huntress; Pfister Journal of the American Chemical Society, 1943 , vol. 65, p. 2167 |
|
~%
2-phenyl-1,3-th... CAS#:38707-83-4 |
| Literature: Erlenmeyer et al. Helvetica Chimica Acta, 1944 , vol. 27, p. 1432,1433 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Phenyl-thiazol-4,5-dicarbonsaeure |
| 2-phenyl-thiazole-4,5-dicarboxylic acid |
| 4,5-Thiazoledicarboxylicacid,2-phenyl |