2 3-DICHLORO-N-PHENYLMALEIMIDE structure
|
Common Name | 2 3-DICHLORO-N-PHENYLMALEIMIDE | ||
|---|---|---|---|---|
| CAS Number | 3876-05-9 | Molecular Weight | 242.05800 | |
| Density | 1.57g/cm3 | Boiling Point | 308.6ºC at 760 mmHg | |
| Molecular Formula | C10H5Cl2NO2 | Melting Point | 198.5-204.5ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 140.5ºC | |
| Name | 3,4-dichloro-1-phenylpyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 308.6ºC at 760 mmHg |
| Melting Point | 198.5-204.5ºC(lit.) |
| Molecular Formula | C10H5Cl2NO2 |
| Molecular Weight | 242.05800 |
| Flash Point | 140.5ºC |
| Exact Mass | 240.97000 |
| PSA | 37.38000 |
| LogP | 2.31400 |
| Index of Refraction | 1.654 |
| InChIKey | CZLKFADFZAWWBC-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)N1c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925190090 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Structure and properties of N-phenylmaleimide derivatives. Bodige SG, et al.
J. Chem. Crystallogr. 29(1) , 57-66, (1999)
|
|
|
A facile synthesis of alkyl substituted maleic anhydrides: radical approach. Messorosh AV, et al.
Tetrahedron 64(48) , 10849-10852, (2008)
|
|
Name: Antifungal activity against Aspergillus flavus ATCC 9170
Source: ChEMBL
Target: Aspergillus flavus
External Id: CHEMBL1776764
|
|
Name: Antifungal activity against Microsporum gypseum C 115 2000
Source: ChEMBL
Target: Nannizzia gypsea
External Id: CHEMBL1776766
|
|
Name: Antifungal activity against Aspergillus niger ATCC 9029
Source: ChEMBL
Target: Aspergillus niger
External Id: CHEMBL1776765
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: Antifungal activity against Candida albicans ATCC 10213
Source: ChEMBL
Target: Candida albicans
External Id: CHEMBL1776637
|
|
Name: Antifungal activity against Saccharomyces cerevisiae ATCC 9763
Source: ChEMBL
Target: Saccharomyces cerevisiae
External Id: CHEMBL1776639
|
|
Name: Antifungal activity against Candida tropicalis C 131 2000
Source: ChEMBL
Target: Candida tropicalis
External Id: CHEMBL1776638
|
|
Name: Antifungal activity against Aspergillus fumigatus ATCC 26934
Source: ChEMBL
Target: Aspergillus fumigatus
External Id: CHEMBL1776641
|
|
Name: Antifungal activity against Cryptococcus neoformans ATCC 32264
Source: ChEMBL
Target: Cryptococcus neoformans
External Id: CHEMBL1776640
|
|
Name: Antifungal activity against Trichophyton mentagrophytes ATCC 9972
Source: ChEMBL
Target: Trichophyton mentagrophytes
External Id: CHEMBL1776805
|
| 3,4-dichloro-1-phenylazoline-2,5-dione |
| N-phenyl-2,3-dichloromaleimide |
| 3,4-Dichlor-1-phenyl-pyrrol-2,5-dion |
| 3,4-dichloro-N-phenylmaleimide |
| 3,4-dichloro-1-phenyl-pyrrole-2,5-dione |
| N-phenyl-3,4-dichloromaleimide |
| 2,3-Dichloro-N-phenylmaleimide |
| 3,4-dichloro-1-phenyl-1H-pyrrole-2,5-dione |
| MFCD00223924 |