1-(2,4,5-trimethoxyphenyl)propan-1-one structure
|
Common Name | 1-(2,4,5-trimethoxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 3904-18-5 | Molecular Weight | 224.25300 | |
| Density | 1.07g/cm3 | Boiling Point | 342.4ºC at 760 mmHg | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.5ºC | |
| Name | 1-(2,4,5-trimethoxyphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 342.4ºC at 760 mmHg |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25300 |
| Flash Point | 150.5ºC |
| Exact Mass | 224.10500 |
| PSA | 44.76000 |
| LogP | 2.30510 |
| Index of Refraction | 1.493 |
| InChIKey | KUQHFNICKXWOBZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cc(OC)c(OC)cc1OC |
| HS Code | 2914509090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-(2,4,5-trimethoxyphenyl)-1-propanone |
| 1-(2',4',5'-trimethoxyphenyl)propan-1-one |
| 2,3-DIHYDRO-4-(4-NITROPHENYL)-1H-1,5-BENZODIAZEPINE |
| 2,4,5-Trimethoxylproriophenone |
| HMS559L19 |
| isoacoramone |
| 2,4,5-trimethoxypropiophenone |
| 1-(2,4,5-Trimethoxy-phenyl)-propan-1-on |