1-Heptyl-4-(4-pyridyl)pyridinium bromide structure
|
Common Name | 1-Heptyl-4-(4-pyridyl)pyridinium bromide | ||
|---|---|---|---|---|
| CAS Number | 39127-10-1 | Molecular Weight | 335.28200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23BrN2 | Melting Point | 125-128ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Heptyl-4-(4-pyridyl)pyridinium bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 125-128ºC(lit.) |
|---|---|
| Molecular Formula | C17H23BrN2 |
| Molecular Weight | 335.28200 |
| Exact Mass | 334.10400 |
| PSA | 16.77000 |
| LogP | 1.01050 |
| InChIKey | GBJHAEPTEZMDHU-UHFFFAOYSA-M |
| SMILES | CCCCCCC[n+]1ccc(-c2ccncc2)cc1.[Br-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~26%
1-Heptyl-4-(4-p... CAS#:39127-10-1 |
| Literature: Barltrop, John A.; Jackson, Andrew C. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 3 p. 367 - 372 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00134461 |
| 1-heptyl-4-pyridin-4-ylpyridin-1-ium,bromide |