2-(4-methylpiperazin-1-yl)-4-phenoxyquinazoline structure
|
Common Name | 2-(4-methylpiperazin-1-yl)-4-phenoxyquinazoline | ||
|---|---|---|---|---|
| CAS Number | 39213-14-4 | Molecular Weight | 320.38800 | |
| Density | 1.214g/cm3 | Boiling Point | 501.7ºC at 760 mmHg | |
| Molecular Formula | C19H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.2ºC | |
| Name | 2-(4-methylpiperazin-1-yl)-4-phenoxyquinazoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 501.7ºC at 760 mmHg |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.38800 |
| Flash Point | 257.2ºC |
| Exact Mass | 320.16400 |
| PSA | 41.49000 |
| LogP | 3.17680 |
| Index of Refraction | 1.641 |
| InChIKey | RZSLGTPILMUKFS-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2nc(Oc3ccccc3)c3ccccc3n2)CC1 |
|
~%
2-(4-methylpipe... CAS#:39213-14-4 |
| Literature: Smits, Rogier A.; De Esch, Iwan J. P.; Zuiderveld, Obbe P.; Broeker, Joachim; Sansuk, Kamonchanok; Guaita, Elena; Coruzzi, Gabriella; Adami, Maristella; Haaksma, Eric; Leurs, Rob Journal of Medicinal Chemistry, 2008 , vol. 51, # 24 p. 7855 - 7865 |
|
~%
2-(4-methylpipe... CAS#:39213-14-4 |
| Literature: Hori; Iemura; Hara; Ozaki; Sukamoto; Ohtaka Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 3 p. 681 - 687 |
|
~%
2-(4-methylpipe... CAS#:39213-14-4 |
| Literature: Hori; Iemura; Hara; Ozaki; Sukamoto; Ohtaka Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 3 p. 681 - 687 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Quinazoline,2-(4-methyl-1-piperazinyl)-4-phenoxy |
| 2-(N-Methylpiperazino)-4-phenoxy-chinazolin |
| 2-(4-Methyl-1-piperazinyl)-4-phenoxyquinazoline |
| 2-(4-methyl-piperazin-1-yl)-4-phenoxy-quinazoline |
| 2-(4-methylpiperazinyl)-4-phenoxyquinazoline |