8-hydroxychlorpromazine structure
|
Common Name | 8-hydroxychlorpromazine | ||
|---|---|---|---|---|
| CAS Number | 3926-67-8 | Molecular Weight | 334.86400 | |
| Density | 1.281g/cm3 | Boiling Point | 513.6ºC at 760 mmHg | |
| Molecular Formula | C17H19ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.4ºC | |
| Name | 8-chloro-10-[3-(dimethylamino)propyl]phenothiazin-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 513.6ºC at 760 mmHg |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.86400 |
| Flash Point | 264.4ºC |
| Exact Mass | 334.09100 |
| PSA | 52.01000 |
| LogP | 4.66500 |
| Index of Refraction | 1.644 |
| InChIKey | UBUDVAYGFVRZCO-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1c2cc(O)ccc2Sc2ccc(Cl)cc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10H-Phenothiazin-2-ol,8-chloro-10-[3-(dimethylamino)propyl] |
| 8-Hydroxychlorpromazine |
| PHENOTHIAZINE,2-CHLORO-10-(3-(DIMETHYLAMINO)PROPYL)-8-HYDROXY |
| 8-chloro-10-(3-dimethylamino-propyl)-10H-phenothiazin-2-ol |
| 8-Hydroxychlorpromazin |
| 2-Chlor-10-(3'-dimethylaminopropyl)-8-hydroxy-phenothiazin |
| 2-chloro-8-hydroxy-10-[ 3-(dimethylamino)propyl]phenothiazine |