3,3',5,5'-Tetrachlor-4,4'-dihydroxydiphenylmethan structure
|
Common Name | 3,3',5,5'-Tetrachlor-4,4'-dihydroxydiphenylmethan | ||
|---|---|---|---|---|
| CAS Number | 3933-88-8 | Molecular Weight | 338.01300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3',5,5'-Tetrachlor-4,4'-dihydroxydiphenylmethan |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8Cl4O2 |
|---|---|
| Molecular Weight | 338.01300 |
| Exact Mass | 335.92800 |
| PSA | 40.46000 |
| LogP | 5.30220 |
| InChIKey | WIFDRXSVRSCMMY-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cc2cc(Cl)c(O)c(Cl)c2)cc1Cl |
| HS Code | 2908199090 |
|---|
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,6,2',6'-Tetrachlor-4,4'-methandiyl-di-phenol |
| Bis-(3.5-dichlor-4-hydroxy-phenyl)-methan |
| bis(4-hydroxy-3,5-dichlorophenyl)-methane |
| 3.5.3'.5'-Tetrachlor-4.4'-dioxy-ditan |
| 2,6,2',6'-tetrachloro-4,4'-methanediyl-di-phenol |