4-Methoxyphenylacetic Anhydride structure
|
Common Name | 4-Methoxyphenylacetic Anhydride | ||
|---|---|---|---|---|
| CAS Number | 3951-10-8 | Molecular Weight | 314.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O5 | Melting Point | 76ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Methoxyphenylacetic Anhydride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 76ºC |
|---|---|
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.33300 |
| Exact Mass | 314.11500 |
| PSA | 61.83000 |
| LogP | 2.55880 |
| Index of Refraction | 1.553 |
| InChIKey | KYCAEIXHUXBNTQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)OC(=O)Cc2ccc(OC)cc2)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26;S36/S37/S39 |
| HS Code | 2918990090 |
|
~%
4-Methoxyphenyl... CAS#:3951-10-8 |
| Literature: Tetrahedron, , vol. 32, p. 2967 - 2971 |
|
~%
4-Methoxyphenyl... CAS#:3951-10-8 |
| Literature: Chemische Berichte, , vol. 102, p. 3922 - 3946 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [2-(4-methoxyphenyl)acetyl] 2-(4-methoxyphenyl)acetate |