2-Chloro-3-nitroaniline structure
|
Common Name | 2-Chloro-3-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 3970-41-0 | Molecular Weight | 172.569 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 318.2±22.0 °C at 760 mmHg | |
| Molecular Formula | C6H5ClN2O2 | Melting Point | 94-95°C | |
| MSDS | N/A | Flash Point | 146.2±22.3 °C | |
| Name | 2-chloro-3-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.2±22.0 °C at 760 mmHg |
| Melting Point | 94-95°C |
| Molecular Formula | C6H5ClN2O2 |
| Molecular Weight | 172.569 |
| Flash Point | 146.2±22.3 °C |
| Exact Mass | 172.003952 |
| PSA | 71.84000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | CMYQDOILKQVRGN-UHFFFAOYSA-N |
| SMILES | Nc1cccc([N+](=O)[O-])c1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921420090 |
|
~62%
2-Chloro-3-nitr... CAS#:3970-41-0 |
| Literature: Sienkowska, Monika; Benin, Vladimir; Kaszynski, Piotr Tetrahedron, 2000 , vol. 56, # 2 p. 165 - 173 |
|
~79%
2-Chloro-3-nitr... CAS#:3970-41-0 |
| Literature: Gan, Zongjie; Hu, Bin; Song, Qiao; Xu, Yungen Synthesis, 2012 , vol. 44, # 7 p. 1074 - 1078 |
|
~%
2-Chloro-3-nitr... CAS#:3970-41-0 |
| Literature: Lamm,B.; Liedholm,B. Acta Chemica Scandinavica (1947-1973), 1967 , vol. 21, p. 2679 - 2688 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Chloro-3-nitrobenzenamine |
| chloronitroaniline |
| 2-chloro-3-nitro-benzenamine |
| Benzenamine,2-chloro-3-nitro |
| 3-nitro-2-chloroaniline |
| ZR BG CNW |
| 2-Chloro-3-nitroaniline |
| 2-chloro-3-nitro-aniline |
| 2-Chlor-3-nitro-anilin |
| Benzenamine, 2-chloro-3-nitro- |