(-)-Corey aldehyde benzoate structure
|
Common Name | (-)-Corey aldehyde benzoate | ||
|---|---|---|---|---|
| CAS Number | 39746-01-5 | Molecular Weight | 274.269 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 470.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O5 | Melting Point | 128-138 °C(lit.) | |
| MSDS | USA | Flash Point | 211.8±28.8 °C | |
| Name | [(3aR,4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.4±45.0 °C at 760 mmHg |
| Melting Point | 128-138 °C(lit.) |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.269 |
| Flash Point | 211.8±28.8 °C |
| Exact Mass | 274.084137 |
| PSA | 69.67000 |
| LogP | 1.14 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | NDHMOBCVFGMXRK-FVCCEPFGSA-N |
| SMILES | O=CC1C(OC(=O)c2ccccc2)CC2OC(=O)CC21 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| (3aR,4R,5R,6aS)-4-Formyl-2-oxohexahydro-2H-cyclopenta[b]furan-5-yl benzoate |
| MFCD02094761 |
| Corey Lactone Aldehyde Benzoate |
| 2H-Cyclopenta[b]furan-4-carboxaldehyde, 5-(benzoyloxy)hexahydro-2-oxo-, (3aR,4R,5R,6aS)- |
| [3aR(3aa,4a,5b,6aa)]-(-)-5-(Benzoyloxy)hexahydro-2-oxo-2H-cyclopenta[b]furan-4-carboxaldehyde |
| 3Beta-Benzoyloxy-2Beta-carboxaldehyde-5Alpha-hydroxy-1Alpha-cyclopentaneacetic Acid Gamma-Lactone |