(-)-Corey lactone benzoate structure
|
Common Name | (-)-Corey lactone benzoate | ||
|---|---|---|---|---|
| CAS Number | 39746-00-4 | Molecular Weight | 276.284 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 481.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H16O5 | Melting Point | 116-120 °C | |
| MSDS | N/A | Flash Point | 183.3±18.1 °C | |
Use of (-)-Corey lactone benzoate(-)-Corey lactone benzoate is a building block in the chemical synthesis of corey aldehyde[1]. |
| Name | (3aR,4S,5R,6aS)-(-)-5-(Benzoyloxy)-hexahydro-4(-hydroxymethyl)-2H-cyclopenta[b]furan-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Corey lactone benzoate is a building block in the chemical synthesis of corey aldehyde[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 481.9±30.0 °C at 760 mmHg |
| Melting Point | 116-120 °C |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.284 |
| Flash Point | 183.3±18.1 °C |
| Exact Mass | 276.099762 |
| PSA | 72.83000 |
| LogP | 0.68 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | OBRRYUZUDKVCOO-FVCCEPFGSA-N |
| SMILES | O=C1CC2C(CC(OC(=O)c3ccccc3)C2CO)O1 |
| Storage condition | -20°C |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S36/37/39-S26 |
|
~69%
(-)-Corey lacto... CAS#:39746-00-4 |
| Literature: Alcon Laboratories, Inc. Patent: US6353000 B1, 2002 ; Location in patent: Page column 10 ; |
|
~%
(-)-Corey lacto... CAS#:39746-00-4 |
| Literature: Jackson, Mark; Dahanukar, Vilas Hareshwar; Joseph, Suju Chuttippari; Eda, Vishnu Vardhana Verma Reddy; Ramdas, Sandip Khobare Patent: US2013/184476 A1, 2013 ; Location in patent: Paragraph 0115 ; |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| (-)-Corey Lactone Benzoate |
| EINECS 254-615-6 |
| (1S,5R,6S,7R)-6-hydroxymethyl-7-benzoyloxy-2-oxabicyclo[3.3.0]octan-3-one |
| (3aR,4S,5R,6aS)-5-(Benzoyloxy)hexahydro-4-(hydroxymethyl)-2H-cyclopenta[b]furan-2-one |
| (3aR,4S,5R,6aS)-4-(Hydroxymethyl)-2-oxohexahydro-2H-cyclopenta[b]furan-5-yl Benzoate |
| (-)-Coreylactonebenzoate |
| 4-(Hydroxymethyl)-2-oxohexahydro-2H-cyclopenta[b]furan-5-yl benzoate |
| [3aR-(3a |
| MFCD00674102 |
| PGX 4 |
| COREY'S LACTONE |
| (3aR,4S,5R,6aS)-5-benzoyloxy-4-(hydroxymethyl)hexahydro-2H-cycolopenta[b]furan-2-one |