1,3-bis(3-chloro-4-methoxyphenyl)thiourea structure
|
Common Name | 1,3-bis(3-chloro-4-methoxyphenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 39861-74-0 | Molecular Weight | 357.25500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14Cl2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(3-chloro-4-methoxyphenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14Cl2N2O2S |
|---|---|
| Molecular Weight | 357.25500 |
| Exact Mass | 356.01500 |
| PSA | 81.65000 |
| LogP | 5.11300 |
| InChIKey | XEEJMQYIPPBMBJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=S)Nc2ccc(OC)c(Cl)c2)cc1Cl |
|
~%
1,3-bis(3-chlor... CAS#:39861-74-0 |
| Literature: Lakhan, Ram; Bhargava, P. N.; Prasad, Salik Journal of the Indian Chemical Society, 1982 , vol. 59, # 6 p. 804 - 806 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-bis-(4'-methoxy-3'-chloro)phenyl thiourea |
| Thiourea,N,N'-bis(3-chloro-4-methoxyphenyl) |
| N,N'-Bis-(3-chlor-4-methoxy-phenyl)-thioharnstoff |