(3-dimethylamino-2,2-dimethyl-propyl) 2-hydroxy-2,2-diphenyl-acetate structure
|
Common Name | (3-dimethylamino-2,2-dimethyl-propyl) 2-hydroxy-2,2-diphenyl-acetate | ||
|---|---|---|---|---|
| CAS Number | 39943-07-2 | Molecular Weight | 341.44400 | |
| Density | 1.101g/cm3 | Boiling Point | 420.1ºC at 760 mmHg | |
| Molecular Formula | C21H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | [3-(dimethylamino)-2,2-dimethylpropyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 420.1ºC at 760 mmHg |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.44400 |
| Flash Point | 207.9ºC |
| Exact Mass | 341.19900 |
| PSA | 49.77000 |
| LogP | 3.05350 |
| Index of Refraction | 1.552 |
| InChIKey | HEPJCOCVFLVXPM-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C)(C)COC(=O)C(O)(c1ccccc1)c1ccccc1 |
|
~%
(3-dimethylamin... CAS#:39943-07-2 |
| Literature: Blicke; Kaplan Journal of the American Chemical Society, 1943 , vol. 65, p. 1967,1968 |
|
~%
(3-dimethylamin... CAS#:39943-07-2 |
| Literature: Newman; Broger; LaPidus; Tye Journal of medicinal chemistry, 1972 , vol. 15, # 10 p. 1003 - 1006 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Dimethylamino-1-benziloyloxy-2.2-dimethyl-propan |