2-chloro-3-nitrobenzotrifluoride structure
|
Common Name | 2-chloro-3-nitrobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 39974-35-1 | Molecular Weight | 225.55200 | |
| Density | 1.537g/cm3 | Boiling Point | 234.6ºC at 760mmHg | |
| Molecular Formula | C7H3ClF3NO2 | Melting Point | 25-30℃ | |
| MSDS | USA | Flash Point | 95.7ºC | |
| Name | 2-Chloro-1-nitro-3-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.537g/cm3 |
|---|---|
| Boiling Point | 234.6ºC at 760mmHg |
| Melting Point | 25-30℃ |
| Molecular Formula | C7H3ClF3NO2 |
| Molecular Weight | 225.55200 |
| Flash Point | 95.7ºC |
| Exact Mass | 224.98000 |
| PSA | 45.82000 |
| LogP | 3.79020 |
| Appearance of Characters | Solid |
| Index of Refraction | 1.493 |
| InChIKey | TWABRHQBRWLSSE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C(F)(F)F)c1Cl |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2904909090 |
|
~0%
2-chloro-3-nitr... CAS#:39974-35-1 |
| Literature: Yazdanbakhsh, Mohammad R.; Mahmoodi, Nosrat O.; Dabiry, Shahram Mendeleev Communications, 2006 , # 3 p. 192 - 194 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 254-724-9 |
| 2-chloro-3-trifluoromethylnitrobenzene |
| 2-chloro-3-nitrobenzotrifluoride |
| 2-Chloro-3-nitrobenzotrifluoride |
| Sorafenib Impurity 24 |