2-Chloro-3-Nitro-Phenol structure
|
Common Name | 2-Chloro-3-Nitro-Phenol | ||
|---|---|---|---|---|
| CAS Number | 603-84-9 | Molecular Weight | 173.55400 | |
| Density | 1.554 g/cm3 | Boiling Point | 279.6ºC at 760 mmHg | |
| Molecular Formula | C6H4ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.9ºC | |
| Name | 2-Chloro-3-Nitro-Phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554 g/cm3 |
|---|---|
| Boiling Point | 279.6ºC at 760 mmHg |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.55400 |
| Flash Point | 122.9ºC |
| Exact Mass | 172.98800 |
| PSA | 66.05000 |
| LogP | 2.47700 |
| Index of Refraction | 1.627 |
| InChIKey | QBGLHYQUZJDZOO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(O)c1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2908999090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-chloro-3-nitro-phenol |