5-Nitrothiophene-2-carbonyl Chloride structure
|
Common Name | 5-Nitrothiophene-2-carbonyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 39978-57-9 | Molecular Weight | 191.59200 | |
| Density | 1.635g/cm3 | Boiling Point | 299.523ºC at 760 mmHg | |
| Molecular Formula | C5H2ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.947ºC | |
| Name | 5-Nitrothiophene-2-carbonyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.635g/cm3 |
|---|---|
| Boiling Point | 299.523ºC at 760 mmHg |
| Molecular Formula | C5H2ClNO3S |
| Molecular Weight | 191.59200 |
| Flash Point | 134.947ºC |
| Exact Mass | 190.94400 |
| PSA | 91.13000 |
| LogP | 2.55850 |
| Index of Refraction | 1.625 |
| InChIKey | BYEANWQDRDXPPA-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])s1 |
| Hazard Codes | T+ |
|---|---|
| Hazard Class | 6.1,8 |
| HS Code | 2934999090 |
|
~%
5-Nitrothiophen... CAS#:39978-57-9 |
| Literature: Khalaf, Abedawn I.; Pitt, Andrew R.; Scobie, Martin; Suckling, Colin J.; Urwin, John; Waigh, Roger D.; Fishleigh, Robert V.; Young, Steven C.; Wylie, William A. Tetrahedron, 2000 , vol. 56, # 29 p. 5225 - 5239 |
|
~%
5-Nitrothiophen... CAS#:39978-57-9 |
| Literature: Threadgill; Webb; O'Neill; Naylor; Stephens; Stratford; Cole; Adams; Fielden Journal of Medicinal Chemistry, 1991 , vol. 34, # 7 p. 2112 - 2120 |
|
~%
5-Nitrothiophen... CAS#:39978-57-9 |
| Literature: Dann Chemische Berichte, 1943 , vol. 76, p. 419,428 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitro-2-thiophenecarbonyl Chloride |
| 5-Nitro-thiophen-2-carbonylchlorid |
| 2-Thiophenecarbonylchloride,5-nitro |
| 5-nitro-thiophene-2-carbonyl chloride |
| 5-Nitrothiophene-2-formyl Chloride |
| 2-chlorocarbonyl-5-nitrothiophene |
| 5-Nitro-2-thenoyl Chloride |
| 5-nitro-thiophene-2-carboxylic acid chloride |