20-Hydroxyganoderic acid G
Modify Date: 2025-08-20 09:15:19
20-Hydroxyganoderic acid G structure
|
Common Name | 20-Hydroxyganoderic acid G | ||
|---|---|---|---|---|
| CAS Number | 400604-12-8 | Molecular Weight | 548.67 | |
| Density | 1.31±0.1 g/cm3(Predicted) | Boiling Point | 760.1±60.0 °C(Predicted) | |
| Molecular Formula | C30H44O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 20-Hydroxyganoderic acid G20-Hydroxyganoderic Acid G is a lanostane triterpenoid obtained from the EtOH extract of fruiting bodies of the Ganoderma curtisii. 20-Hydroxyganoderic Acid G inhibits BV-2 microglia cells activated by LPS with an IC50 of 21.33 μM. 20-Hydroxyganoderic Acid G has therapeutic potential in the drug discovery of nerve inflammation diseases associated with microglia activated by LPS[1]. |
| Name | 20-Hydroxyganoderic acid G |
|---|
| Description | 20-Hydroxyganoderic Acid G is a lanostane triterpenoid obtained from the EtOH extract of fruiting bodies of the Ganoderma curtisii. 20-Hydroxyganoderic Acid G inhibits BV-2 microglia cells activated by LPS with an IC50 of 21.33 μM. 20-Hydroxyganoderic Acid G has therapeutic potential in the drug discovery of nerve inflammation diseases associated with microglia activated by LPS[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.31±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 760.1±60.0 °C(Predicted) |
| Molecular Formula | C30H44O9 |
| Molecular Weight | 548.67 |
| InChIKey | HHCQRNABFNZPFW-PVWQPZRVSA-N |
| SMILES | CC(CC(=O)CC(C)(O)C1CC(=O)C2(C)C3=C(C(=O)C(O)C12C)C1(C)CCC(O)C(C)(C)C1CC3O)C(=O)O |