3-(5-methylfuran-2-yl)benzoic acid structure
|
Common Name | 3-(5-methylfuran-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 400746-01-2 | Molecular Weight | 202.20600 | |
| Density | 1.215g/cm3 | Boiling Point | 362.5ºC at 760 mmHg | |
| Molecular Formula | C12H10O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 173ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-(5-methylfuran-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 362.5ºC at 760 mmHg |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.20600 |
| Flash Point | 173ºC |
| Exact Mass | 202.06300 |
| PSA | 50.44000 |
| LogP | 2.95320 |
| Index of Refraction | 1.574 |
| InChIKey | ZGYKYVFYWKVVED-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cccc(C(=O)O)c2)o1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-(5-methyl-2-furyl)benzoic Acid |