3-(5-Nitropyridin-2-yl)benzoic acid structure
|
Common Name | 3-(5-Nitropyridin-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 864075-95-6 | Molecular Weight | 244.20300 | |
| Density | 1.417 g/cm3 | Boiling Point | 477.3ºC at 760 mmHg | |
| Molecular Formula | C12H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.4ºC | |
| Name | 3-(5-Nitropyridin-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417 g/cm3 |
|---|---|
| Boiling Point | 477.3ºC at 760 mmHg |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.20300 |
| Flash Point | 242.4ºC |
| Exact Mass | 244.04800 |
| PSA | 96.01000 |
| LogP | 2.87820 |
| Index of Refraction | 1.644 |
| InChIKey | NLHLQKGYMCYSQS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(-c2ccc([N+](=O)[O-])cn2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~88%
3-(5-Nitropyrid... CAS#:864075-95-6 |
| Literature: SPIROGEN LIMITED Patent: WO2005/85177 A2, 2005 ; Location in patent: Page/Page column 50-51 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(5-nitropyridin-2-yl)benzoic acid |