2-(9,10-dioxoanthracen-1-yl)isoindole-1,3-dione structure
|
Common Name | 2-(9,10-dioxoanthracen-1-yl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 40101-29-9 | Molecular Weight | 353.32700 | |
| Density | 1.494g/cm3 | Boiling Point | 619.2ºC at 760 mmHg | |
| Molecular Formula | C22H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.1ºC | |
| Name | 2-(9,10-dioxoanthracen-1-yl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.494g/cm3 |
|---|---|
| Boiling Point | 619.2ºC at 760 mmHg |
| Molecular Formula | C22H11NO4 |
| Molecular Weight | 353.32700 |
| Flash Point | 306.1ºC |
| Exact Mass | 353.06900 |
| PSA | 71.52000 |
| LogP | 3.32760 |
| Index of Refraction | 1.731 |
| InChIKey | KBLFCHZTXMGMCV-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1cccc2N1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(9,10-Dioxo-9,10-dihydro-anthracen-1-yl)-isoindole-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione,2-(9,10-dihydro-9,10-dioxo-1-anthracenyl) |
| N-(9,10-dioxo-9,10-dihydro-anthracen-1-yl)-phthalimide |
| 1-Phthalimidoanthrachinon |
| AmbscM0185 |
| Phthalamide,N-1-anthraquinonyl |