2-(1-diethylaminopropan-2-yl)isoindole-1,3-dione structure
|
Common Name | 2-(1-diethylaminopropan-2-yl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 92648-52-7 | Molecular Weight | 260.33100 | |
| Density | 1.141g/cm3 | Boiling Point | 363.5ºC at 760 mmHg | |
| Molecular Formula | C15H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.9ºC | |
| Name | 2-[1-(diethylamino)propan-2-yl]isoindole-1,3-dione |
|---|
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760 mmHg |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.33100 |
| Flash Point | 145.9ºC |
| Exact Mass | 260.15200 |
| PSA | 40.62000 |
| LogP | 1.95080 |
| Index of Refraction | 1.56 |
| InChIKey | RGFKOOZRPSXRKG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(C)N1C(=O)c2ccccc2C1=O |
|
~%
2-(1-diethylami... CAS#:92648-52-7 |
| Literature: Moore; Rapala Journal of the American Chemical Society, 1946 , vol. 68, p. 1657 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |