tetrathiafulvalene 7 7 8 8-tetracyano- structure
|
Common Name | tetrathiafulvalene 7 7 8 8-tetracyano- | ||
|---|---|---|---|---|
| CAS Number | 40210-84-2 | Molecular Weight | 408.54300 | |
| Density | N/A | Boiling Point | 254.7ºC at 760 mmHg | |
| Molecular Formula | C18H8N4S4 | Melting Point | --230ºC (dec.) | |
| MSDS | USA | Flash Point | 99.7ºC | |
| Name | 2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile,2-(1,3-dithiol-2-ylidene)-1,3-dithiole |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 254.7ºC at 760 mmHg |
|---|---|
| Melting Point | --230ºC (dec.) |
| Molecular Formula | C18H8N4S4 |
| Molecular Weight | 408.54300 |
| Flash Point | 99.7ºC |
| Exact Mass | 407.96300 |
| PSA | 196.36000 |
| LogP | 4.09772 |
| InChIKey | OIXMVDHMELKBDX-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C2SC=CS2)S1.N#CC(C#N)=c1ccc(=C(C#N)C#N)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | UN 3439 6.1/PG III |
| WGK Germany | 3 |
| Packaging Group | III |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
A biosensor for monitoring formaldehyde using a new lipophilic tetrathiafulvalene-tetracyanoquinodimethane salt and a polyurethane membrane.
Talanta 3rd ed., 56 , 451-458, (2002) A format for a disposable screen-printed biosensor was investigated for monitoring formaldehyde. The screen-printed sensor format comprised a working electrode (WE) modified with platinised carbon, a ... |
| Tetrathiafulvalene - 7,7,8,8-TetracyanoquinodiMethane CoMplex |
| TTF-TCNQ Complex |
| TCNQ-TTF |
| Tetrathiafulvalene 7,7,8,8-tetracyanoquinodimethane salt |
| Tetrathiafulvalen-Tetracyanchinondimethan |
| TTF-TCNQ |
| MFCD03791115 |
| T2468 |