Tetracyanoquinodimethane structure
|
Common Name | Tetracyanoquinodimethane | ||
|---|---|---|---|---|
| CAS Number | 1518-16-7 | Molecular Weight | 204.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 254.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H4N4 | Melting Point | 287-289 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 99.7±21.2 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | tetracyanoquinodimethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 254.7±40.0 °C at 760 mmHg |
| Melting Point | 287-289 °C (dec.)(lit.) |
| Molecular Formula | C12H4N4 |
| Molecular Weight | 204.187 |
| Flash Point | 99.7±21.2 °C |
| Exact Mass | 204.043594 |
| PSA | 95.16000 |
| LogP | -0.36 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | PCCVSPMFGIFTHU-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=c1ccc(=C(C#N)C#N)cc1 |
| Stability | Stable. Incompatible with strong acids, strong bases, strong reducing agents, strong oxidizing agents. |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331 |
| Precautionary Statements | P261-P280-P301 + P310-P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S24/25-S36/37-S26 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | GU4850000 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 29269095 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Novel organic solvents for electrochemistry at the liquid/liquid interface.
Analyst 140(6) , 1947-54, (2015) Two-phase voltammetry has been carried out using a reverse cell configuration, i.e. with the lower density organic solvent on the top of the aqueous solution in the cell, where the organic solvents co... |
|
|
Charge-transfer crystallites as molecular electrical dopants.
Nat. Commun. 6 , 8560, (2015) Ground-state integer charge transfer is commonly regarded as the basic mechanism of molecular electrical doping in both, conjugated polymers and oligomers. Here, we demonstrate that fundamentally diff... |
|
|
Impact of Association Colloids on Lipid Oxidation in Triacylglycerols and Fatty Acid Ethyl Esters.
J. Agric. Food Chem. 63 , 10161-9, (2015) The impact of association colloids on lipid oxidation in triacylglycerols and fatty acid ethyl esters was investigated. Association colloids did not affect lipid oxidation of high oleic safflower and ... |
| 2-[4-(dicyanomethylidene)cyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| (2,5-Cyclohexadiene-1,4-diylidene)-dimalononitrile |
| Propanedinitrile, 2,2'- (2,5-cyclohexadiene-1,4-diylidene)bis- |
| 2,2'-cyclohexa-2,5-diene-1,4-diylidenedipropanedinitrile |
| 7,7',8,8'-Tetracyanoquinodimethane |
| MFCD00011664 |
| 2,2'-(2,5-Cyclohexadiene-1,4-diylidene)dimalononitrile |
| 2,2'-Cyclohexa-2,5-diene-1,4-diylidenedimalononitrile |
| Propanedinitrile, 2,2'-(2,5-cyclohexadiene-1,4-diylidene)bis- |
| TCNQ |
| Tetracyanoquinodimethane |
| 2,2'-(Cyclohexa-2,5-diene-1,4-diylidene)dimalononitrile |
| 2-[4-(dicyanomethylidene)cyclohexa-2,5-dienyliden]malononitrile |
| EINECS 216-174-8 |
| 7,7,8,8-Tetracyanoquinodimethane |