Imidodicarbonimidicdiamide, N-(4-chlorophenyl)-, hydrochloride (1:1) structure
|
Common Name | Imidodicarbonimidicdiamide, N-(4-chlorophenyl)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4022-81-5 | Molecular Weight | 248.11200 | |
| Density | N/A | Boiling Point | 426.4ºC at 760 mmHg | |
| Molecular Formula | C8H11Cl2N5 | Melting Point | 239-242 °C(lit.) | |
| MSDS | USA | Flash Point | 211.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(4-chlorophenyl)biguanide hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 426.4ºC at 760 mmHg |
|---|---|
| Melting Point | 239-242 °C(lit.) |
| Molecular Formula | C8H11Cl2N5 |
| Molecular Weight | 248.11200 |
| Flash Point | 211.7ºC |
| Exact Mass | 247.03900 |
| PSA | 97.78000 |
| LogP | 3.33540 |
| Vapour Pressure | 1.78E-07mmHg at 25°C |
| InChIKey | NAFSLMFLGYXGIF-UHFFFAOYSA-N |
| SMILES | Cl.NC(N)=NC(N)=Nc1ccc(Cl)cc1 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DU1780200 |
|
~83%
Imidodicarbonim... CAS#:4022-81-5 |
| Literature: Chen, Huixiong; Dao, Pascal; Laporte, Alice; Garbay, Christiane Tetrahedron Letters, 2010 , vol. 51, # 24 p. 3174 - 3176 |
| Precursor 1 | |
|---|---|
| DownStream 9 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-(p-chlorophenyl)biguanidehydrochloride |
| amp |
| BUTTPARK 451-24 |
| 1-(4-CHLOROPHENYL)BIGUANIDE HYDROCHLOR& imidodicarbonimidic diamide,N-(4-chlorophenyl) |
| 1-(p-Chlorophenyl)biguanide Monohydrochloride |
| N-(4-chlorophenyl)imidodicarbonimidic diamide hydrochloride |
| N1-4'-chlorophenyl-biguanide hydrochloride |
| 1-(4-Chlorophenyl)biguanideHCl |
| N1-(p-Chlorophenyl)biguanide hydrochloride |
| MFCD00053020 |
| 1-(p-Chlorophenyl)biguanide Monohydroch |
| 1-(4-Chlor-phenyl)-biguanid,Hydrochlorid |
| 1-(p-chlorophenyl)-biguanidmonohydrochloride |
| 1-(4-chloro-phenyl)-biguanide,hydrochloride |