Piperazine,1-[(4-nitrophenyl)methyl]-4-phenyl- structure
|
Common Name | Piperazine,1-[(4-nitrophenyl)methyl]-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 40224-22-4 | Molecular Weight | 297.35200 | |
| Density | 1.224g/cm3 | Boiling Point | 455.3ºC at 760mmHg | |
| Molecular Formula | C17H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2ºC | |
| Name | 1-[(4-nitrophenyl)methyl]-4-phenylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 455.3ºC at 760mmHg |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.35200 |
| Flash Point | 229.2ºC |
| Exact Mass | 297.14800 |
| PSA | 52.30000 |
| LogP | 3.44310 |
| Index of Refraction | 1.623 |
| InChIKey | PIBSNEKGYCHCSG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CN2CCN(c3ccccc3)CC2)cc1 |
|
~90%
Piperazine,1-[(... CAS#:40224-22-4 |
| Literature: Roglic; Dukic-Stefanovic; Andric; Kostic-Rajacic; Soskic Die Pharmazie, 2001 , vol. 56, # 10 p. 803 - 807 |
|
~%
Piperazine,1-[(... CAS#:40224-22-4 |
| Literature: Boehringer Ingelheim GmbH Patent: US3937708 A1, 1976 ; |
|
~%
Piperazine,1-[(... CAS#:40224-22-4 |
| Literature: The Upjohn Company Patent: US4140775 A1, 1979 ; |
|
~%
Piperazine,1-[(... CAS#:40224-22-4 |
| Literature: Akzo Nobel N.V. Patent: US6486354 B1, 2002 ; |
| 4-(4-phenyl-piperazinyl-methyl)-nitrobenzene |
| 1-phenyl-4-(p-nitrobenzyl)piperazine |
| 1-(4-nitrobenzyl)-4-phenylpiperazine |
| 4-(4-phenyl-piperazin-1-yl-methyl)-nitrobenzene |
| 4-(4-phenylpiperazine-1-ylmethyl)-1-nitrobenzene |
| N-Phenyl-N'-(4-nitro-benzyl)-piperazine |