4,6-Diphenyl-2-pyrimidinamine structure
|
Common Name | 4,6-Diphenyl-2-pyrimidinamine | ||
|---|---|---|---|---|
| CAS Number | 40230-24-8 | Molecular Weight | 247.294 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 496.8±48.0 °C at 760 mmHg | |
| Molecular Formula | C16H13N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.5±16.8 °C | |
| Name | 4,6-Diphenylpyrimidin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 496.8±48.0 °C at 760 mmHg |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.294 |
| Flash Point | 286.5±16.8 °C |
| Exact Mass | 247.110947 |
| PSA | 52.53000 |
| LogP | 3.88 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | KZUCBEYDRUCBCS-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyrimidinamine, 4,6-diphenyl- |
| 4,6-Diphenyl-2-pyrimidinamine |
| 4,6-diphenylpyrimidin-2-amine |