perchlorocyclohex-2-en-1-one structure
|
Common Name | perchlorocyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 4024-81-1 | Molecular Weight | 371.68800 | |
| Density | 1.92g/cm3 | Boiling Point | 308ºC at 760 mmHg | |
| Molecular Formula | C6Cl8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.3ºC | |
| Name | och |
|---|---|
| Synonym | More Synonyms |
| Density | 1.92g/cm3 |
|---|---|
| Boiling Point | 308ºC at 760 mmHg |
| Molecular Formula | C6Cl8O |
| Molecular Weight | 371.68800 |
| Flash Point | 129.3ºC |
| Exact Mass | 367.74600 |
| PSA | 17.07000 |
| LogP | 4.78000 |
| Vapour Pressure | 0.000698mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | CZLVPINBLDRZCJ-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(Cl)C(Cl)(Cl)C(Cl)(Cl)C1(Cl)Cl |
| HS Code | 2914700090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| octachloro-cyclohex-2-enone |
| perchlorocyclohex-2-en-1-one |
| 2,3,4,4,5,5,6,6-octachloro-2-cyclohexenone |
| Octachlor-cyclohex-2-enon |
| 2,3,4,4,5,5,6,6-octachloro-2-cyclohexen-1-one |
| Perchlorocyclohex-2-en-1-one |
| 2,3,4,4,5,5,6,6-Octachloro cyclohex-2-ene-1-one |
| 2,3,4,4,5,5,6,6-octachlorocyclohex-2-en-1-one |
| octachlorocyclohexenone |
| Oktachlor-cyclohexen-(1)-on-(3) |
| UNII-F66SE2O4G7 |