HEXACHLORO-2,5-CYCLOHEXADIEN-1-ONE structure
|
Common Name | HEXACHLORO-2,5-CYCLOHEXADIEN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 599-52-0 | Molecular Weight | 300.78200 | |
| Density | 1.85g/cm3 | Boiling Point | 318.6ºC at 760 mmHg | |
| Molecular Formula | C6Cl6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134ºC | |
Summary: 2,3,4,4,5,6-Hexachlorocyclohexa-2,5-dien-1-one (CAS: 599-52-0), molecular formula: C6Cl6O, molecular weight: 300.78200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.85g/cm3 |
|---|---|
| Boiling Point | 318.6ºC at 760 mmHg |
| Molecular Formula | C6Cl6O |
| Molecular Weight | 300.78200 |
| Flash Point | 134ºC |
| Exact Mass | 297.80800 |
| PSA | 17.07000 |
| LogP | 4.12140 |
| Index of Refraction | 1.602 |
| InChIKey | SLKWROUNLHVIIQ-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 9 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dienone |
| 2,3,4,4,5,6-hexachloro-2,5-cyclohexadiene-1-one |
| Hexachloro-2,5-cyclohexadienone |
| 2,3,4,4,5,6-hexachlorocyclohexa 2,5-dien 1-one |
| Hexachlor-cyclohexa-2,5-dienon |
| hexachloro-cyclohexa-2,5-dienone |
| Pentachlorphenol-chlor |
| USAF DO-65 |
| Hexachloro-2,5-cyclohexadien-1-one |
| Hexachlorfenol [Czech] |
| hexachlorocyclohexa-2,5-dien-1-one |
| 2,3,4,4,5,6-hexachloro-cyclohexadiene-(2,5)-one-(1) |
| Hexachlorocyclohexadienone |
| Hexachlorfenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: Related downstream products(CAS) of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one: 1441-02-7;75-44-5;118-74-1;3019-98-5;118-75-2;87-86-5;7497-08-7;6912-20-5;5435-61-0. |
| Q: What is the LogP of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: LogP of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one is 4.12140. |
| Q: What is the English name of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: The English name of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one is 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one. |
| Q: What is the SMILES notation of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: SMILES notation of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one is O=C1C(Cl)=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl. |
| Q: What is the boiling point of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: Boiling point of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one is 318.6ºC at 760 mmHg. |
| Q: What is the Chinese name of 599-52-0? |
| A: Chinese name of 599-52-0 is 599-52-0. |
| Q: What is the InChIKey of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: InChIKey of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one is SLKWROUNLHVIIQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: Molecular weight of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one is 300.78200. |
| Q: What is the molecular formula of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: Molecular formula of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one is C6Cl6O. |
| Q: What is the polar surface area (PSA) of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one? |
| A: Polar surface area (PSA) of 2,3,4,4,5,6-hexachlorocyclohexa-2,5-dien-1-one is 17.07000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |