(5E)-5-(morpholin-4-ylmethylidene)-2-thiabicyclo[5.4.0]undeca-7,9,11-trien-6-one structure
|
Common Name | (5E)-5-(morpholin-4-ylmethylidene)-2-thiabicyclo[5.4.0]undeca-7,9,11-trien-6-one | ||
|---|---|---|---|---|
| CAS Number | 40322-48-3 | Molecular Weight | 275.36600 | |
| Density | 1.3g/cm3 | Boiling Point | 445.7ºC at 760 mmHg | |
| Molecular Formula | C15H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
| Name | (4E)-4-(morpholin-4-ylmethylidene)-2,3-dihydro-1-benzothiepin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 445.7ºC at 760 mmHg |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.36600 |
| Flash Point | 223.3ºC |
| Exact Mass | 275.09800 |
| PSA | 54.84000 |
| LogP | 2.51910 |
| Index of Refraction | 1.67 |
| InChIKey | GFNNVBCHHIFDGM-VAWYXSNFSA-N |
| SMILES | O=C1C(=CN2CCOCC2)CCSc2ccccc21 |
|
~%
(5E)-5-(morphol... CAS#:40322-48-3 |
| Literature: Traynelis,V.J. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 2629 - 2637 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-morpholin-4-ylmethylene-3,4-dihydro-2H-benzo[b]thiepin-5-one |