1-methoxy-6-nitro-benzotriazole structure
|
Common Name | 1-methoxy-6-nitro-benzotriazole | ||
|---|---|---|---|---|
| CAS Number | 40422-82-0 | Molecular Weight | 194.14800 | |
| Density | 1.62g/cm3 | Boiling Point | 351ºC at 760 mmHg | |
| Molecular Formula | C7H6N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.1ºC | |
| Name | 1-methoxy-6-nitrobenzotriazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 351ºC at 760 mmHg |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.14800 |
| Flash Point | 166.1ºC |
| Exact Mass | 194.04400 |
| PSA | 85.76000 |
| LogP | 0.92110 |
| Index of Refraction | 1.709 |
| InChIKey | VTSGUSOSMBPCHJ-UHFFFAOYSA-N |
| SMILES | COn1nnc2ccc([N+](=O)[O-])cc21 |
|
~%
1-methoxy-6-nit... CAS#:40422-82-0 |
| Literature: Brady; Day Journal of the Chemical Society, 1923 , vol. 123, p. 2266 |
|
~%
1-methoxy-6-nit... CAS#:40422-82-0 |
| Literature: Brady; Day Journal of the Chemical Society, 1923 , vol. 123, p. 2266 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-methoxy-6-nitro-benzotriazole |
| 1-Methoxy-6-nitro-1H-benzotriazol |
| 1-methoxy-6-nitro-1H-benzotriazole |
| 1-methoxy-6-nitro-1,2,3-benzotriazole |