(2S)-2-(2,4,5-trichlorophenoxy)propanoic acid structure
|
Common Name | (2S)-2-(2,4,5-trichlorophenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 40521-06-0 | Molecular Weight | 269.50900 | |
| Density | 1.52g/cm3 | Boiling Point | 378.4ºC at 760mmHg | |
| Molecular Formula | C9H7Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.6ºC | |
| Name | (2S)-2-(2,4,5-trichlorophenoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 378.4ºC at 760mmHg |
| Molecular Formula | C9H7Cl3O3 |
| Molecular Weight | 269.50900 |
| Flash Point | 182.6ºC |
| Exact Mass | 267.94600 |
| PSA | 46.53000 |
| LogP | 3.49870 |
| InChIKey | ZLSWBLPERHFHIS-BYPYZUCNSA-N |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)O |
|
~80%
(2S)-2-(2,4,5-t... CAS#:40521-06-0 |
| Literature: Burkard, Ulrike; Effenberger, Franz Chemische Berichte, 1986 , vol. 119, # 5 p. 1594 - 1612 |
|
~%
(2S)-2-(2,4,5-t... CAS#:40521-06-0 |
| Literature: Burkard, Ulrike; Effenberger, Franz Chemische Berichte, 1986 , vol. 119, # 5 p. 1594 - 1612 |
|
~%
(2S)-2-(2,4,5-t... CAS#:40521-06-0 |
| Literature: Malik, Ashok Kumar; Aulakh, Jatinder Singh; Fekete, Agnes; Philippe, Schmitt-Kopplin Journal of the Chinese Chemical Society, 2009 , vol. 56, # 6 p. 1163 - 1167 |
|
~%
(2S)-2-(2,4,5-t... CAS#:40521-06-0 |
| Literature: Smith et al. Annals of Applied Biology, 1952 , vol. 39, p. 295,297, 298 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| (S)-2-(2,4,5-trichlorophenoxy)propanoic acid |
| (R)-2-(2,4,5-Trichlorphenoxy)propionsaeure |
| L-2-(2,4,5-trichloro-phenoxy)-propionic acid |
| (-)-Silvex |
| (S)-fenoprop |
| Fenoprop,(-) |
| L-2-(2,4,5-Trichlor-phenoxy)-propionsaeure |