H-Met-Thr-OH structure
|
Common Name | H-Met-Thr-OH | ||
|---|---|---|---|---|
| CAS Number | 40883-16-7 | Molecular Weight | 250.315 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 539.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C9H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.1±30.1 °C | |
Use of H-Met-Thr-OHH-Met-Thr-OH is a dipeptide[1]. |
| Name | H-Met-Thr-OH |
|---|---|
| Synonym | More Synonyms |
| Description | H-Met-Thr-OH is a dipeptide[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 539.5±50.0 °C at 760 mmHg |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.315 |
| Flash Point | 280.1±30.1 °C |
| Exact Mass | 250.098724 |
| LogP | -0.83 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | KAKJTZWHIUWTTD-VQVTYTSYSA-N |
| SMILES | CSCCC(N)C(=O)NC(C(=O)O)C(C)O |
| L-Threonine, L-methionyl- |
| L-Methionyl-L-threonine |
| MFCD00083779 |