3,5,6-Trichlorosalicylic acid structure
|
Common Name | 3,5,6-Trichlorosalicylic acid | ||
|---|---|---|---|---|
| CAS Number | 40932-60-3 | Molecular Weight | 241.456 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 335.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H3Cl3O3 | Melting Point | 209-211 °C(lit.) | |
| MSDS | N/A | Flash Point | 156.4±27.9 °C | |
| Name | 3,5,6-Trichlorosalicylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.0±42.0 °C at 760 mmHg |
| Melting Point | 209-211 °C(lit.) |
| Molecular Formula | C7H3Cl3O3 |
| Molecular Weight | 241.456 |
| Flash Point | 156.4±27.9 °C |
| Exact Mass | 239.914780 |
| PSA | 57.53000 |
| LogP | 4.66 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | IIHCUZVBIMTHEB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(O)c(Cl)cc(Cl)c1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/22;R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2918290000 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 2,3,5-Trichloro-6-hydroxybenzoic acid |
| 3,5,6-Trichloro-2-hydroxybenzoic Acid |
| MFCD00075245 |
| 3,5,6-Trichlorosalicylic acid |
| EINECS 255-144-9 |
| Benzoic acid, 2,3,5-trichloro-6-hydroxy- |